Compound Q&A

What are the physical and chemical properties of tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9)?

Answer

tert-Butyl (5-bromothiophen-2-yl)carbamate
Tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) is a white to off-white crystalline solid with a molecular weight of approximately 314.03 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and dichloromethane. This compound is known for its high reactivity, particularly towards nucleophiles, and is often used in organic synthesis due to its bromine-containing thiophene moiety.

About

English Name tert-Butyl (5-bromothiophen-2-yl)carbamate
Molecular Formula C9H12BrNO2S
Molecular Weight 278.17 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=C(S1)Br
InChIKey SKPRAKMCHAPMNY-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) typically synthesized?

Tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) can be synthesized via a multi-step pr...

Compound Q&A

What industries use tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9)?

Tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) is primarily used in pharmaceutical an...

Compound Q&A

What precautions should be taken when handling tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9)?

When handling tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9), it is crucial to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...