Compound Q&A

What industries use Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

Answer

Ethyl 3,5-dichlorobenzoate
Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry for modifying properties of polymers and in the sensor industry for developing specialized chemical sensors. Its use in semiconductor production is also notable due to its electronic properties.

About

CAS No 91085-56-2
English Name Ethyl 3,5-dichlorobenzoate
Molecular Formula C9H8Cl2O2
Molecular Weight 219.07 g/mol
SMILES CCOC(=O)C1=CC(=CC(=C1)Cl)Cl
InChIKey JRLNLVFPSMDPLU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is a crystalline compound with a high melting point. It...

Compound Q&A

How is Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) typically synthesized?

Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is typically synthesized via the reaction of 3,5-dichlo...

Compound Q&A

What precautions should be taken when handling Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

When handling Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2), appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...