Compound Q&A

What are the physical and chemical properties of Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

Answer

Ethyl 3,5-dichlorobenzoate
Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is a crystalline compound with a high melting point. Its molecular weight is approximately 228.04 g/mol. It has limited solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong bases and reducing agents. It is used in the synthesis of other compounds due to its functional groups.

About

CAS No 91085-56-2
English Name Ethyl 3,5-dichlorobenzoate
Molecular Formula C9H8Cl2O2
Molecular Weight 219.07 g/mol
SMILES CCOC(=O)C1=CC(=CC(=C1)Cl)Cl
InChIKey JRLNLVFPSMDPLU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) typically synthesized?

Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is typically synthesized via the reaction of 3,5-dichlo...

Compound Q&A

What industries use Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

When handling Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2), appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...