Compound Q&A

How is Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) typically synthesized?

Answer

Ethyl 3,5-dichlorobenzoate
Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is typically synthesized via the reaction of 3,5-dichlorobenzoic acid with ethyl bromide in the presence of a base such as potassium carbonate. The process involves esterification, and the yield can be around 85-90%. The reaction is conducted at room temperature and under mild conditions to ensure selectivity and high purity.

About

CAS No 91085-56-2
English Name Ethyl 3,5-dichlorobenzoate
Molecular Formula C9H8Cl2O2
Molecular Weight 219.07 g/mol
SMILES CCOC(=O)C1=CC(=CC(=C1)Cl)Cl
InChIKey JRLNLVFPSMDPLU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is a crystalline compound with a high melting point. It...

Compound Q&A

What industries use Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2) is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2)?

When handling Ethyl 3,5-dichlorobenzoate (CAS: 91085-56-2), appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...