Compound Q&A

How is Cardamom oil (CAS: 8000-66-6) typically synthesized?

Answer

Cardamom oil
Cardamom oil (CAS: 8000-66-6) can be synthesized through the steam distillation of cardamom seeds. The primary components, e.g., eugenol and methyl eugenol, are extracted from the cardamom plant. This process involves heating cardamom seeds with steam, which carries the volatile compounds into a condenser where the oil is collected. Other methods include solvent extraction, though steam distillation is more common for its efficiency and minimal environmental impact.

About

CAS No 8000-66-6
English Name Cardamom oil
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
EINECS 000-000-0
SMILES O1C(C(=O)O)=C(C2C=CC=CC1=2)N1C=CC=C1
InChIKey YCTXQBNFNACZHO-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cardamom oil (CAS: 8000-66-6)?

Cardamom oil (CAS: 8000-66-6) is a yellow to greenish-brown liquid with a strong, spicy aroma. Its m...

Compound Q&A

What industries use Cardamom oil (CAS: 8000-66-6)?

Cardamom oil (CAS: 8000-66-6) is widely used in the food and beverage industry for flavoring beverag...

Compound Q&A

What precautions should be taken when handling Cardamom oil (CAS: 8000-66-6)?

When handling Cardamom oil (CAS: 8000-66-6), it is essential to wear personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...