Compound Q&A

What are the physical and chemical properties of Cardamom oil (CAS: 8000-66-6)?

Answer

Cardamom oil
Cardamom oil (CAS: 8000-66-6) is a yellow to greenish-brown liquid with a strong, spicy aroma. Its molecular weight is approximately 162.23 g/mol. Cardamom oil is moderately soluble in ethanol and other organic solvents but is poorly soluble in water. It is moderately reactive, especially in the presence of oxygen and light, and can degrade over time if not stored properly. It is often used in aromatherapy and flavoring due to its unique scent and taste.

About

CAS No 8000-66-6
English Name Cardamom oil
Molecular Formula C13H9NO3
Molecular Weight 227.22 g/mol
EINECS 000-000-0
SMILES O1C(C(=O)O)=C(C2C=CC=CC1=2)N1C=CC=C1
InChIKey YCTXQBNFNACZHO-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Cardamom oil (CAS: 8000-66-6) typically synthesized?

Cardamom oil (CAS: 8000-66-6) can be synthesized through the steam distillation of cardamom seeds. T...

Compound Q&A

What industries use Cardamom oil (CAS: 8000-66-6)?

Cardamom oil (CAS: 8000-66-6) is widely used in the food and beverage industry for flavoring beverag...

Compound Q&A

What precautions should be taken when handling Cardamom oil (CAS: 8000-66-6)?

When handling Cardamom oil (CAS: 8000-66-6), it is essential to wear personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...