Compound Q&A

What precautions should be taken when handling (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

Answer

(2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn when handling this compound. It should be stored in a well-ventilated area and handled in a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate safety procedures, and the Material Safety Data Sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 13504-86-4
English Name (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid
Molecular Formula C13H15NO5
Molecular Weight 265.27 g/mol
SMILES O[C@H]1C[C@H](N(C1)C(=O)OCc2ccccc2)C(=O)O
InChIKey WWVCWLBEARZMAH-QWRGUYRKSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

The compound has a crystalline form and a molecular weight of approximately 288.25 g/mol. It is slig...

Compound Q&A

How is (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4) typically synthesized?

This compound is typically synthesized through a multi-step process involving the protection of a pr...

Compound Q&A

What industries use (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

This compound is used in the pharmaceutical industry for the synthesis of various drug molecules. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...