Compound Q&A

How is (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4) typically synthesized?

Answer

(2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid
This compound is typically synthesized through a multi-step process involving the protection of a primary alcohol with a benzyloxycarbonyl group, followed by the introduction of the carboxylic acid functionality. The synthesis often involves the use of coupling reagents and protecting group strategies to ensure selective modifications.

About

CAS No 13504-86-4
English Name (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid
Molecular Formula C13H15NO5
Molecular Weight 265.27 g/mol
SMILES O[C@H]1C[C@H](N(C1)C(=O)OCc2ccccc2)C(=O)O
InChIKey WWVCWLBEARZMAH-QWRGUYRKSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

The compound has a crystalline form and a molecular weight of approximately 288.25 g/mol. It is slig...

Compound Q&A

What industries use (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

This compound is used in the pharmaceutical industry for the synthesis of various drug molecules. It...

Compound Q&A

What precautions should be taken when handling (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...