Compound Q&A

What are the physical and chemical properties of (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

Answer

(2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid
The compound has a crystalline form and a molecular weight of approximately 288.25 g/mol. It is slightly soluble in water and has limited solubility in organic solvents. The compound is known for its reactivity in esterification and amidation reactions due to the presence of the carboxylic acid and hydroxyl functionalities.

About

CAS No 13504-86-4
English Name (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid
Molecular Formula C13H15NO5
Molecular Weight 265.27 g/mol
SMILES O[C@H]1C[C@H](N(C1)C(=O)OCc2ccccc2)C(=O)O
InChIKey WWVCWLBEARZMAH-QWRGUYRKSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4) typically synthesized?

This compound is typically synthesized through a multi-step process involving the protection of a pr...

Compound Q&A

What industries use (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

This compound is used in the pharmaceutical industry for the synthesis of various drug molecules. It...

Compound Q&A

What precautions should be taken when handling (2S,4S)-1-[(benzyloxy)carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid (CAS: 13504-86-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...