Compound Q&A

What precautions should be taken when handling Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Answer

Methyl 3,4,5-trifluorobenzoate
When handling Methyl 3,4,5-trifluorobenzoate, it is essential to use appropriate personal protective equipment (PPE), including safety goggles, gloves, and a lab coat. This compound should be used in a well-ventilated fume hood to prevent inhalation. In case of a spill, it is recommended to use appropriate absorbent materials and follow local disposal regulations. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name Methyl 3,4,5-trifluorobenzoate
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1)F)F)F
InChIKey NBBPHMUHCCIOJQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Methyl 3,4,5-trifluorobenzoate is a crystalline compound with a molecular weight of approximately 19...

Compound Q&A

How is Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6) typically synthesized?

Methyl 3,4,5-trifluorobenzoate is typically synthesized by the reaction of 3,4,5-trifluorobenzoic ac...

Compound Q&A

What industries use Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Methyl 3,4,5-trifluorobenzoate is primarily used in the pharmaceutical and organic synthesis industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...