Compound Q&A

What are the physical and chemical properties of Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Answer

Methyl 3,4,5-trifluorobenzoate
Methyl 3,4,5-trifluorobenzoate is a crystalline compound with a molecular weight of approximately 197.07 g/mol. It has a low solubility in water but is readily soluble in organic solvents like methanol and acetonitrile. The compound is known for its stability, but it can react with strong bases to form trifluorobenzoic acid. It is often used in organic synthesis and as a building block in the pharmaceutical industry.

About

English Name Methyl 3,4,5-trifluorobenzoate
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1)F)F)F
InChIKey NBBPHMUHCCIOJQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6) typically synthesized?

Methyl 3,4,5-trifluorobenzoate is typically synthesized by the reaction of 3,4,5-trifluorobenzoic ac...

Compound Q&A

What industries use Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Methyl 3,4,5-trifluorobenzoate is primarily used in the pharmaceutical and organic synthesis industr...

Compound Q&A

What precautions should be taken when handling Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

When handling Methyl 3,4,5-trifluorobenzoate, it is essential to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...