Compound Q&A

What industries use Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Answer

Methyl 3,4,5-trifluorobenzoate
Methyl 3,4,5-trifluorobenzoate is primarily used in the pharmaceutical and organic synthesis industries. It serves as a key intermediate in the synthesis of various pharmaceutical compounds and is also used in the development of advanced materials, including polymers and sensors. Its unique chemical properties make it a valuable reagent in these fields.

About

English Name Methyl 3,4,5-trifluorobenzoate
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES COC(=O)C1=CC(=C(C(=C1)F)F)F
InChIKey NBBPHMUHCCIOJQ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

Methyl 3,4,5-trifluorobenzoate is a crystalline compound with a molecular weight of approximately 19...

Compound Q&A

How is Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6) typically synthesized?

Methyl 3,4,5-trifluorobenzoate is typically synthesized by the reaction of 3,4,5-trifluorobenzoic ac...

Compound Q&A

What precautions should be taken when handling Methyl 3,4,5-trifluorobenzoate (CAS: 773873-72-6)?

When handling Methyl 3,4,5-trifluorobenzoate, it is essential to use appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...