Compound Q&A

What industries use N-[(8S)-4-Amino-6-methyl-5-(3-quinolinyl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]acrylamide (CAS: 1661854-97-2)?

Answer

N-[(8S)-4-Amino-6-methyl-5-(3-quinolinyl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]acrylamide
This compound is primarily used in the pharmaceutical industry for its potential as an intermediate in the development of novel drugs. It may also find applications in polymer chemistry for the synthesis of functional materials and in sensor technology for its ability to detect specific analytes.

About

English Name N-[(8S)-4-Amino-6-methyl-5-(3-quinolinyl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]acrylamide
Molecular Formula C23H20N6O
Molecular Weight 396.45 g/mol
SMILES CC1=C[C@@H](Cn2c1c(c3c2ncnc3N)c4cc5ccccc5nc4)NC(=O)C=C
InChIKey MKCYPWYURWOKST-INIZCTEOSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(8S)-4-Amino-6-methyl-5-(3-quinolinyl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]acrylamide (CAS: 1661854-97-2)?

The compound is a crystalline solid with a high molecular weight around 600 g/mol. It has good solub...

Compound Q&A

How is N-[(8S)-4-Amino-6-methyl-5-(3-quinolinyl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]acrylamide (CAS: 1661854-97-2) typically synthesized?

This compound is typically synthesized through a multistep procedure involving the reaction of 3-qui...

Compound Q&A

What precautions should be taken when handling N-[(8S)-4-Amino-6-methyl-5-(3-quinolinyl)-8,9-dihydropyrimido[5,4-b]indolizin-8-yl]acrylamide (CAS: 1661854-97-2)?

When handling this compound, safety goggles and gloves must be worn to prevent skin contact and eye ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...