Compound Q&A

What industries use (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3)?

Answer

(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid finds applications in the pharmaceutical industry, particularly in the development of drug candidates targeting specific enzymes and receptors. It is also used in the polymer industry for the synthesis of functional polymers, and in the sensor industry for the development of biosensors and chemosensors. Additionally, it has potential applications in the semiconductor industry for the formation of metal-organic frameworks.

About

CAS No 4125-93-3
English Name (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES CC(C)(C)OC(=O)C(CC(=O)O)N
InChIKey PUWCNJZIFKBDJQ-YFKPBYRVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3)?

(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid is a white crystalline solid with a mol...

Compound Q&A

How is (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3) typically synthesized?

(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid is synthesized through a multi-step pro...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3)?

When handling (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid, it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...