Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3)?

Answer

(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid is a white crystalline solid with a molecular weight of approximately 210.32 g/mol. It is slightly soluble in water and has a pKa of around 4.3. This compound is reactive towards nucleophiles and can undergo various chemical transformations such as esterification and amidation. It is also prone to hydrolysis under basic conditions.

About

CAS No 4125-93-3
English Name (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES CC(C)(C)OC(=O)C(CC(=O)O)N
InChIKey PUWCNJZIFKBDJQ-YFKPBYRVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3) typically synthesized?

(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid is synthesized through a multi-step pro...

Compound Q&A

What industries use (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3)?

(3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid finds applications in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 4125-93-3)?

When handling (3S)-3-Amino-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid, it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...