Compound Q&A

What industries use Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7)?

Answer

Ethyl 4,6-dichloro-1H-indole-2-carboxylate
Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) is used in the pharmaceutical industry for the synthesis of intermediates and drug precursors. It can also be utilized in polymer chemistry for the development of novel materials and in the production of sensors and semiconductors.

About

CAS No 53995-82-7
English Name Ethyl 4,6-dichloro-1H-indole-2-carboxylate
Molecular Formula C11H9Cl2NO2
Molecular Weight 258.1 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C=C(C=C2Cl)Cl
InChIKey YLAHLUPONQVSOT-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7)?

Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) is a white to off-white crystalline sol...

Compound Q&A

How is Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) typically synthesized?

Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) is typically synthesized through a mult...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7)?

When handling Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...