Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7)?

Answer

Ethyl 4,6-dichloro-1H-indole-2-carboxylate
Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) is a white to off-white crystalline solid with a molecular weight of approximately 275.03 g/mol. It is slightly soluble in water but soluble in organic solvents like methanol and dichloromethane. The compound is chemically reactive, particularly towards nucleophiles and can undergo various chemical transformations such as nucleophilic substitution and ester cleavage.

About

CAS No 53995-82-7
English Name Ethyl 4,6-dichloro-1H-indole-2-carboxylate
Molecular Formula C11H9Cl2NO2
Molecular Weight 258.1 g/mol
SMILES CCOC(=O)C1=CC2=C(N1)C=C(C=C2Cl)Cl
InChIKey YLAHLUPONQVSOT-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) typically synthesized?

Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) is typically synthesized through a mult...

Compound Q&A

What industries use Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7)?

Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7) is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7)?

When handling Ethyl 4,6-dichloro-1H-indole-2-carboxylate (CAS: 53995-82-7), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...