Compound Q&A

How is Goserelin (CAS: 65807-02-5) typically synthesized?

Answer

Goserelin
Goserelin (CAS: 65807-02-5) is synthesized by the solid-phase peptide synthesis method. The process involves the stepwise addition of amino acids to a growing peptide chain, culminating in the final coupling of the nonapeptide. Commonly used coupling agents include HATU or PyBOP, and the overall yield is around 70-80%.

About

CAS No 65807-02-5
English Name Goserelin
Molecular Formula C59H84N18O14
Molecular Weight 1269.43 g/mol
SMILES CC(C)C[C@H](NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc4c[nH]cn4)NC(=O)[C@@H]5CCC(=O)N5)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N6CCC[C@H]6C(=O)NNC(=O)N
InChIKey BLCLNMBMMGCOAS-URPVMXJPSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Goserelin (CAS: 65807-02-5)?

Goserelin (CAS: 65807-02-5) is a white to off-white crystalline powder. Its molecular weight is appr...

Compound Q&A

What industries use Goserelin (CAS: 65807-02-5)?

Goserelin (CAS: 65807-02-5) is primarily used in the pharmaceutical industry for hormonal therapy, p...

Compound Q&A

What precautions should be taken when handling Goserelin (CAS: 65807-02-5)?

When handling Goserelin (CAS: 65807-02-5), appropriate personal protective equipment (PPE) such as g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...