Compound Q&A

What precautions should be taken when handling Sagittatoside B (CAS: 118525-36-3)?

Answer

Sagittatoside B
When handling Sagittatoside B (CAS: 118525-36-3), wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Store in a cool, dry place away from strong acids and bases. Use a fume hood during preparation to minimize inhalation risk. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name Sagittatoside B
Molecular Formula C32H38O14
Molecular Weight 646.6420000000006 g/mol
SMILES COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O
InChIKey BVDGQVAUJNUPGW-JGSSSOFVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Sagittatoside B (CAS: 118525-36-3) typically synthesized?

Sagittatoside B (CAS: 118525-36-3) is synthesized via a multi-step reaction involving coupling and o...

Compound Q&A

What industries use Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is primarily used in the pharmaceutical industry for its potentia...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...