Compound Q&A

What precautions should be taken when handling Sagittatoside B (CAS: 118525-36-3)?

Answer

Sagittatoside B
When handling Sagittatoside B (CAS: 118525-36-3), wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Store in a cool, dry place away from strong acids and bases. Use a fume hood during preparation to minimize inhalation risk. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name Sagittatoside B
Molecular Formula C32H38O14
Molecular Weight 646.64 g/mol
SMILES COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O
InChIKey BVDGQVAUJNUPGW-JGSSSOFVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Sagittatoside B (CAS: 118525-36-3) typically synthesized?

Sagittatoside B (CAS: 118525-36-3) is synthesized via a multi-step reaction involving coupling and o...

Compound Q&A

What industries use Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is primarily used in the pharmaceutical industry for its potentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...