Compound Q&A

What are the physical and chemical properties of Sagittatoside B (CAS: 118525-36-3)?

Answer

Sagittatoside B
Sagittatoside B (CAS: 118525-36-3) is a crystalline compound with a molecular weight of approximately 494.43 g/mol. It is slightly soluble in water and organic solvents. The compound is stable under normal conditions but may react with strong acids or bases. It is often used in pharmaceutical and natural product research.

About

English Name Sagittatoside B
Molecular Formula C32H38O14
Molecular Weight 646.6420000000006 g/mol
SMILES COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O
InChIKey BVDGQVAUJNUPGW-JGSSSOFVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is Sagittatoside B (CAS: 118525-36-3) typically synthesized?

Sagittatoside B (CAS: 118525-36-3) is synthesized via a multi-step reaction involving coupling and o...

Compound Q&A

What industries use Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is primarily used in the pharmaceutical industry for its potentia...

Compound Q&A

What precautions should be taken when handling Sagittatoside B (CAS: 118525-36-3)?

When handling Sagittatoside B (CAS: 118525-36-3), wear appropriate personal protective equipment (PP...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...