Compound Q&A

How is Sagittatoside B (CAS: 118525-36-3) typically synthesized?

Answer

Sagittatoside B
Sagittatoside B (CAS: 118525-36-3) is synthesized via a multi-step reaction involving coupling and oxidation processes. The synthesis usually employs catalytic conditions with mild oxidants and is known for its good selectivity and yield. The process requires careful control of reaction conditions to achieve high purity.

About

English Name Sagittatoside B
Molecular Formula C32H38O14
Molecular Weight 646.6420000000006 g/mol
SMILES COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O
InChIKey BVDGQVAUJNUPGW-JGSSSOFVSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use Sagittatoside B (CAS: 118525-36-3)?

Sagittatoside B (CAS: 118525-36-3) is primarily used in the pharmaceutical industry for its potentia...

Compound Q&A

What precautions should be taken when handling Sagittatoside B (CAS: 118525-36-3)?

When handling Sagittatoside B (CAS: 118525-36-3), wear appropriate personal protective equipment (PP...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...