Compound Q&A

What industries use 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

Answer

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is primarily used in the pharmaceutical industry for drug development. It may also find applications in the production of functional polymers and as a precursor in the synthesis of other bioactive molecules. Its use in sensors and semiconductors is less common but possible due to its unique chemical structure.

About

English Name 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
Molecular Formula C15H30O9
Molecular Weight 354.4 g/mol
SMILES OCCOCCOCCOCCOCCOCCOCCC(=O)O
InChIKey LGLHJMFNIHYJBM-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is a solid compound with a high molecular weig...

Compound Q&A

How is 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9) typically synthesized?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid can be synthesized through a series of alkylat...

Compound Q&A

What precautions should be taken when handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

When handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid, it is important to use proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...