Compound Q&A

What industries use 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

Answer

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is primarily used in the pharmaceutical industry for drug development. It may also find applications in the production of functional polymers and as a precursor in the synthesis of other bioactive molecules. Its use in sensors and semiconductors is less common but possible due to its unique chemical structure.

About

English Name 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
Molecular Formula C15H30O9
Molecular Weight 354.39600000000013 g/mol
SMILES OCCOCCOCCOCCOCCOCCOCCC(=O)O
InChIKey LGLHJMFNIHYJBM-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is a solid compound with a high molecular weig...

Compound Q&A

How is 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9) typically synthesized?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid can be synthesized through a series of alkylat...

Compound Q&A

What precautions should be taken when handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

When handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid, it is important to use proper p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...