Compound Q&A

What are the physical and chemical properties of 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

Answer

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is a solid compound with a high molecular weight. It has limited solubility in common organic solvents like ethanol and methanol. The compound is relatively stable under normal conditions but can react with strong bases. It is not flammable but should be handled with care due to its reactivity.

About

English Name 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
Molecular Formula C15H30O9
Molecular Weight 354.4 g/mol
SMILES OCCOCCOCCOCCOCCOCCOCCC(=O)O
InChIKey LGLHJMFNIHYJBM-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9) typically synthesized?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid can be synthesized through a series of alkylat...

Compound Q&A

What industries use 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

When handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid, it is important to use proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...