Compound Q&A

How is 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9) typically synthesized?

Answer

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid can be synthesized through a series of alkylation and hydroxylation reactions. The key steps involve the introduction of multiple hydroxyl groups and the formation of the carboxylic acid group. Common catalysts include Transition metals like palladium or platinum, and the reaction is typically carried out under anhydrous conditions to ensure high selectivity and yield.

About

English Name 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid
Molecular Formula C15H30O9
Molecular Weight 354.4 g/mol
SMILES OCCOCCOCCOCCOCCOCCOCCC(=O)O
InChIKey LGLHJMFNIHYJBM-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is a solid compound with a high molecular weig...

Compound Q&A

What industries use 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid (CAS: 1347750-85-9)?

When handling 1-Hydroxy-3,6,9,12,15,18-hexaoxahenicosan-21-oic acid, it is important to use proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...