Compound Q&A

What precautions should be taken when handling 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

Answer

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate
When handling 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Always work in a well-ventilated area or fume hood to minimize exposure to fumes. Spills should be cleaned up using appropriate absorbent materials and the area should be thoroughly washed with water. Refer to the safety data sheet (SDS) for detailed emergency procedures and storage guidelines.

About

English Name 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.32 g/mol
SMILES COC(=O)C1CCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey BMBZPWAQRLLZBC-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) is a crystalline compound with a mo...

Compound Q&A

How is 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) typically synthesized?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) can be synthesized through a multi-...

Compound Q&A

What industries use 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) is primarily used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...