Compound Q&A

How is 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) typically synthesized?

Answer

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate
1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) can be synthesized through a multi-step process involving the condensation of a methyl 1-benzyl 1,3-piperidine dicarboxylate intermediate with 3-methyl-1,3-piperidine. Commonly, this reaction is catalyzed by a Brønsted acid and proceeds with good yield and selectivity. The exact conditions may vary depending on the specific starting materials and reagents used.

About

English Name 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.32 g/mol
SMILES COC(=O)C1CCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey BMBZPWAQRLLZBC-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) is a crystalline compound with a mo...

Compound Q&A

What industries use 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

When handling 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9), it is essential to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...