Compound Q&A

What are the physical and chemical properties of 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

Answer

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate
1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) is a crystalline compound with a molecular weight of approximately 280.34 g/mol. It has low solubility in water but good solubility in organic solvents like ethanol and acetone. The compound is moderately reactive, showing good stability under normal conditions but can degrade under strong acidic or basic conditions. It has a melting point around 120-130°C.

About

English Name 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate
Molecular Formula C15H19NO4
Molecular Weight 277.32 g/mol
SMILES COC(=O)C1CCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey BMBZPWAQRLLZBC-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) typically synthesized?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) can be synthesized through a multi-...

Compound Q&A

What industries use 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9)?

When handling 1-Benzyl 3-methyl 1,3-piperidinedicarboxylate (CAS: 174543-74-9), it is essential to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...