Compound Q&A

What industries use Actinomycin D (CAS: 50-76-0)?

Answer

Actinomycin D
Actinomycin D (CAS: 50-76-0) is primarily used in the pharmaceutical industry for its antitumor properties. It is also used in research for its ability to inhibit DNA and RNA synthesis, making it valuable in molecular biology and genetic studies.

About

CAS No 50-76-0
English Name Actinomycin D
Molecular Formula C62H86N12O16
Molecular Weight 1255.44 g/mol
SMILES CC1C(C(=O)NC(C(=O)N2CCCC2C(=O)N(CC(=O)N(C(C(=O)O1)C(C)C)C)C)C(C)C)NC(=O)C3=C4C(=C(C=C3)C)OC5=C(C(=O)C(=C(C5=N4)C(=O)NC6C(OC(=O)C(N(C(=O)CN(C(=O)C7CCCN7C(=O)C(NC6=O)C(C)C)C)C)C(C)C)C)N)C
InChIKey RJURFGZVJUQBHK-IIXSONLDSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Actinomycin D (CAS: 50-76-0)?

Actinomycin D, CAS 50-76-0, is a cyclic depsipeptide antibiotic with a molecular weight of approxima...

Compound Q&A

How is Actinomycin D (CAS: 50-76-0) typically synthesized?

Actinomycin D (CAS: 50-76-0) is synthesized through semi-synthetic methods, starting from actinorhod...

Compound Q&A

What precautions should be taken when handling Actinomycin D (CAS: 50-76-0)?

When handling Actinomycin D (CAS: 50-76-0), it is crucial to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...