Compound Q&A

How is Actinomycin D (CAS: 50-76-0) typically synthesized?

Answer

Actinomycin D
Actinomycin D (CAS: 50-76-0) is synthesized through semi-synthetic methods, starting from actinorhodin, a natural product from Streptomyces bacteria. The synthesis involves several steps, including acetylation, cyclization, and modification of the molecule's structure to achieve the desired antitumor activity.

About

CAS No 50-76-0
English Name Actinomycin D
Molecular Formula C62H86N12O16
Molecular Weight 1255.44 g/mol
SMILES CC1C(C(=O)NC(C(=O)N2CCCC2C(=O)N(CC(=O)N(C(C(=O)O1)C(C)C)C)C)C(C)C)NC(=O)C3=C4C(=C(C=C3)C)OC5=C(C(=O)C(=C(C5=N4)C(=O)NC6C(OC(=O)C(N(C(=O)CN(C(=O)C7CCCN7C(=O)C(NC6=O)C(C)C)C)C)C(C)C)C)N)C
InChIKey RJURFGZVJUQBHK-IIXSONLDSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Actinomycin D (CAS: 50-76-0)?

Actinomycin D, CAS 50-76-0, is a cyclic depsipeptide antibiotic with a molecular weight of approxima...

Compound Q&A

What industries use Actinomycin D (CAS: 50-76-0)?

Actinomycin D (CAS: 50-76-0) is primarily used in the pharmaceutical industry for its antitumor prop...

Compound Q&A

What precautions should be taken when handling Actinomycin D (CAS: 50-76-0)?

When handling Actinomycin D (CAS: 50-76-0), it is crucial to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...