Compound Q&A

What industries use [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

Answer

[4-(Trifluoromethoxy)phenoxy]acetic acid
[4-(Trifluoromethoxy)phenoxy]acetic acid is used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs due to its unique chemical structure. It also has applications in the polymer industry for the modification of polymer properties, and in the manufacturing of sensors and semiconductors for their specific performance characteristics.

About

CAS No 72220-50-9
English Name [4-(Trifluoromethoxy)phenoxy]acetic acid
Molecular Formula C9H7F3O4
Molecular Weight 236.14 g/mol
SMILES C1=CC(=CC=C1OCC(=O)O)OC(F)(F)F
InChIKey QHSBEEUEIRDHCD-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

[4-(Trifluoromethoxy)phenoxy]acetic acid is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9) typically synthesized?

[4-(Trifluoromethoxy)phenoxy]acetic acid can be synthesized by the condensation of 4-(trifluorometho...

Compound Q&A

What precautions should be taken when handling [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

When handling [4-(Trifluoromethoxy)phenoxy]acetic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...