Compound Q&A

How is [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9) typically synthesized?

Answer

[4-(Trifluoromethoxy)phenoxy]acetic acid
[4-(Trifluoromethoxy)phenoxy]acetic acid can be synthesized by the condensation of 4-(trifluoromethoxy)phenol with acetic anhydride in the presence of a catalytic amount of sulfuric acid. The reaction is typically carried out at room temperature and involves the formation of an ester through an acylation process. The product is purified by recrystallization from ethanol or a suitable solvent.

About

CAS No 72220-50-9
English Name [4-(Trifluoromethoxy)phenoxy]acetic acid
Molecular Formula C9H7F3O4
Molecular Weight 236.14 g/mol
SMILES C1=CC(=CC=C1OCC(=O)O)OC(F)(F)F
InChIKey QHSBEEUEIRDHCD-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

[4-(Trifluoromethoxy)phenoxy]acetic acid is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

[4-(Trifluoromethoxy)phenoxy]acetic acid is used in the pharmaceutical industry as an intermediate i...

Compound Q&A

What precautions should be taken when handling [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

When handling [4-(Trifluoromethoxy)phenoxy]acetic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...