Compound Q&A

What are the physical and chemical properties of [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

Answer

[4-(Trifluoromethoxy)phenoxy]acetic acid
[4-(Trifluoromethoxy)phenoxy]acetic acid is a white crystalline solid with a molecular weight of approximately 287.05 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and chloroform. The compound exhibits acidic properties due to the carboxylic acid functional group. It is reactive under certain conditions, particularly in the presence of strong bases or reducing agents.

About

CAS No 72220-50-9
English Name [4-(Trifluoromethoxy)phenoxy]acetic acid
Molecular Formula C9H7F3O4
Molecular Weight 236.14 g/mol
SMILES C1=CC(=CC=C1OCC(=O)O)OC(F)(F)F
InChIKey QHSBEEUEIRDHCD-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9) typically synthesized?

[4-(Trifluoromethoxy)phenoxy]acetic acid can be synthesized by the condensation of 4-(trifluorometho...

Compound Q&A

What industries use [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

[4-(Trifluoromethoxy)phenoxy]acetic acid is used in the pharmaceutical industry as an intermediate i...

Compound Q&A

What precautions should be taken when handling [4-(Trifluoromethoxy)phenoxy]acetic acid (CAS: 72220-50-9)?

When handling [4-(Trifluoromethoxy)phenoxy]acetic acid, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...