Compound Q&A

What industries use 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

Answer

2,4-Dibromo-5-nitropyridine
2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) is used in the pharmaceutical industry for the synthesis of various drugs, as well as in the polymer industry for the development of novel materials. It also finds applications in sensor technology and semiconductor manufacturing.

About

CAS No 4487-57-4
English Name 2,4-Dibromo-5-nitropyridine
Molecular Formula C5H2Br2N2O2
Molecular Weight 281.89 g/mol
SMILES C1=C(C(=CN=C1Br)[N+](=O)[O-])Br
InChIKey RZZGFCFQBVRQSX-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) typically synthesized?

2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) can be synthesized by the bromination of 5-nitropyridin...

Compound Q&A

What precautions should be taken when handling 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

Proper handling of 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) requires the use of appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...