Compound Q&A

What are the physical and chemical properties of 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

Answer

2,4-Dibromo-5-nitropyridine
2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) is a crystalline solid with a molecular weight of approximately 308.04 g/mol. It is slightly soluble in water and more soluble in organic solvents like methanol and ethanol. The compound is reactive due to the presence of the nitro and bromine groups, which can participate in nucleophilic and electrophilic reactions. It has a melting point of around 155-157°C.

About

CAS No 4487-57-4
English Name 2,4-Dibromo-5-nitropyridine
Molecular Formula C5H2Br2N2O2
Molecular Weight 281.89 g/mol
SMILES C1=C(C(=CN=C1Br)[N+](=O)[O-])Br
InChIKey RZZGFCFQBVRQSX-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) typically synthesized?

2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) can be synthesized by the bromination of 5-nitropyridin...

Compound Q&A

What industries use 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

Proper handling of 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) requires the use of appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...