Compound Q&A

How is 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) typically synthesized?

Answer

2,4-Dibromo-5-nitropyridine
2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) can be synthesized by the bromination of 5-nitropyridine using bromine in the presence of a Lewis acid catalyst, such as aluminum bromide. The reaction typically proceeds with a yield of around 85%, and the product can be purified by recrystallization.

About

CAS No 4487-57-4
English Name 2,4-Dibromo-5-nitropyridine
Molecular Formula C5H2Br2N2O2
Molecular Weight 281.89 g/mol
SMILES C1=C(C(=CN=C1Br)[N+](=O)[O-])Br
InChIKey RZZGFCFQBVRQSX-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4)?

Proper handling of 2,4-Dibromo-5-nitropyridine (CAS: 4487-57-4) requires the use of appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...