Compound Q&A

What precautions should be taken when handling 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

Answer

1H-Benzimidazole-4-carboxylic acid
When handling 1H-Benzimidazole-4-carboxylic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure that the work is conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents, and proper safety data sheets (SDS) should be consulted for detailed emergency response procedures.

About

CAS No 46006-36-4
English Name 1H-Benzimidazole-4-carboxylic acid
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC(=C2C(=C1)NC=N2)C(=O)O
InChIKey VVQNAFBGAWCMLU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

1H-Benzimidazole-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

How is 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4) typically synthesized?

1H-Benzimidazole-4-carboxylic acid can be synthesized through the condensation of 2-amino-1-benzimid...

Compound Q&A

What industries use 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

1H-Benzimidazole-4-carboxylic acid is used primarily in the pharmaceutical industry for the synthesi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...