Compound Q&A

What are the physical and chemical properties of 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

Answer

1H-Benzimidazole-4-carboxylic acid
1H-Benzimidazole-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 182.18 g/mol. It is slightly soluble in water and has limited solubility in common organic solvents. Chemically, it is relatively stable but can undergo hydrolysis under basic conditions. It is used in various applications requiring its chemical reactivity and specific functional groups.

About

CAS No 46006-36-4
English Name 1H-Benzimidazole-4-carboxylic acid
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC(=C2C(=C1)NC=N2)C(=O)O
InChIKey VVQNAFBGAWCMLU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4) typically synthesized?

1H-Benzimidazole-4-carboxylic acid can be synthesized through the condensation of 2-amino-1-benzimid...

Compound Q&A

What industries use 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

1H-Benzimidazole-4-carboxylic acid is used primarily in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

When handling 1H-Benzimidazole-4-carboxylic acid, it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...