Compound Q&A

How is 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4) typically synthesized?

Answer

1H-Benzimidazole-4-carboxylic acid
1H-Benzimidazole-4-carboxylic acid can be synthesized through the condensation of 2-amino-1-benzimidazole with formic acid. The reaction typically involves heating under basic conditions, followed by purification steps to isolate the desired product. This method ensures high selectivity and yield, making it a common route for laboratory and industrial production.

About

CAS No 46006-36-4
English Name 1H-Benzimidazole-4-carboxylic acid
Molecular Formula C8H6N2O2
Molecular Weight 162.15 g/mol
SMILES C1=CC(=C2C(=C1)NC=N2)C(=O)O
InChIKey VVQNAFBGAWCMLU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

1H-Benzimidazole-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 1...

Compound Q&A

What industries use 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

1H-Benzimidazole-4-carboxylic acid is used primarily in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 1H-Benzimidazole-4-carboxylic acid (CAS: 46006-36-4)?

When handling 1H-Benzimidazole-4-carboxylic acid, it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...