Compound Q&A

What precautions should be taken when handling 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

Answer

3,4-Dichloro-N-(2-pentanyl)benzamide
When handling 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure good ventilation in the work area and handle the compound in a fume hood. In case of a spill, immediately clean it up using appropriate absorbent materials and follow laboratory safety protocols. Always refer to the Safety Data Sheet (SDS) for detailed guidance.

About

CAS No 7497-07-6
English Name 3,4-Dichloro-N-(2-pentanyl)benzamide
Molecular Formula C12H15Cl2NO
Molecular Weight 260.16 g/mol
SMILES CCCC(C)NC(=O)c1ccc(c(c1)Cl)Cl
InChIKey ARDYECYBETXQFD-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) is a crystalline compound with a molecular wei...

Compound Q&A

How is 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) typically synthesized?

3,4-Dichloro-N-(2-pentanyl)benzamide is typically synthesized via a condensation reaction between 3,...

Compound Q&A

What industries use 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) is primarily used in the pharmaceutical indust...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...