Compound Q&A

What are the physical and chemical properties of 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

Answer

3,4-Dichloro-N-(2-pentanyl)benzamide
3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) is a crystalline compound with a molecular weight of approximately 265.03 g/mol. Its solubility in water is very low, and it is soluble in organic solvents such as methanol and ethanol. Chemically, it is relatively stable but can react with strong nucleophiles. It has a pKa of about 7.5.

About

CAS No 7497-07-6
English Name 3,4-Dichloro-N-(2-pentanyl)benzamide
Molecular Formula C12H15Cl2NO
Molecular Weight 260.16 g/mol
SMILES CCCC(C)NC(=O)c1ccc(c(c1)Cl)Cl
InChIKey ARDYECYBETXQFD-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) typically synthesized?

3,4-Dichloro-N-(2-pentanyl)benzamide is typically synthesized via a condensation reaction between 3,...

Compound Q&A

What industries use 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

When handling 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6), it is essential to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...