Compound Q&A

What industries use 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

Answer

3,4-Dichloro-N-(2-pentanyl)benzamide
3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the development of certain polymer additives and in the electronics sector for semiconductor applications.

About

CAS No 7497-07-6
English Name 3,4-Dichloro-N-(2-pentanyl)benzamide
Molecular Formula C12H15Cl2NO
Molecular Weight 260.16 g/mol
SMILES CCCC(C)NC(=O)c1ccc(c(c1)Cl)Cl
InChIKey ARDYECYBETXQFD-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) is a crystalline compound with a molecular wei...

Compound Q&A

How is 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6) typically synthesized?

3,4-Dichloro-N-(2-pentanyl)benzamide is typically synthesized via a condensation reaction between 3,...

Compound Q&A

What precautions should be taken when handling 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6)?

When handling 3,4-Dichloro-N-(2-pentanyl)benzamide (CAS: 7497-07-6), it is essential to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...