Compound Q&A

What precautions should be taken when handling 5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6)?

Answer

5-Chloro-4-fluoro-2-nitroaniline
5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6) should be handled with caution due to its reactivity and potential for forming explosive compounds. Always perform operations in a well-ventilated fume hood and use appropriate personal protective equipment (PPE), such as gloves, goggles, and a lab coat. Store the compound in a cool, dry place away from sources of ignition and incompatible materials. Refer to the Material Safety Data Sheet (MSDS) for more detailed safety information.

About

English Name 5-Chloro-4-fluoro-2-nitroaniline
Molecular Formula C6H4ClFN2O2
Molecular Weight 190.56 g/mol
SMILES C1=C(C(=CC(=C1Cl)F)[N+](=O)[O-])N
InChIKey VRJKEIWZSOHDOH-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6)?

5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6) typically synthesized?

5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6) can be synthesized through the nitration of 4-ch...

Compound Q&A

What industries use 5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6)?

5-Chloro-4-fluoro-2-nitroaniline (CAS: 104222-34-6) is used in various industries including pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...