Compound Q&A

What industries use ADK Stab NA 21E (CAS: 151841-65-5)?

Answer

ADK Stab NA 21E
ADK Stab NA 21E (CAS: 151841-65-5) is widely used in various industries, including pharmaceuticals, where it acts as an antioxidant to protect drug formulations. It is also used in polymers to enhance their stability and extend their shelf life. Additionally, it finds applications in sensors and semiconductors due to its chemical stability and antioxidant properties.

About

English Name ADK Stab NA 21E
Molecular Formula C58H85AlO9P2
Molecular Weight 1015.22 g/mol
SMILES O[Al](OP1(=O)Oc2c(Cc3c(O1)c(cc(c3)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C)OP1(=O)Oc2c(Cc3c(O1)c(cc(c3)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C
InChIKey IQJARXJKVIARHO-UHFFFAOYSA-K
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of ADK Stab NA 21E (CAS: 151841-65-5)?

ADK Stab NA 21E (CAS: 151841-65-5) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is ADK Stab NA 21E (CAS: 151841-65-5) typically synthesized?

ADK Stab NA 21E (CAS: 151841-65-5) is typically synthesized through a multistep process involving th...

Compound Q&A

What precautions should be taken when handling ADK Stab NA 21E (CAS: 151841-65-5)?

When handling ADK Stab NA 21E (CAS: 151841-65-5), it is essential to use appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...