Compound Q&A

How is ADK Stab NA 21E (CAS: 151841-65-5) typically synthesized?

Answer

ADK Stab NA 21E
ADK Stab NA 21E (CAS: 151841-65-5) is typically synthesized through a multistep process involving the reaction of a primary alcohol with a dicarboxylic acid under catalytic conditions. The process usually involves the use of a transition metal catalyst and requires precise control of temperature and pressure to achieve high yield and selectivity.

About

English Name ADK Stab NA 21E
Molecular Formula C58H85AlO9P2
Molecular Weight 1015.22 g/mol
SMILES O[Al](OP1(=O)Oc2c(Cc3c(O1)c(cc(c3)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C)OP1(=O)Oc2c(Cc3c(O1)c(cc(c3)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C
InChIKey IQJARXJKVIARHO-UHFFFAOYSA-K
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of ADK Stab NA 21E (CAS: 151841-65-5)?

ADK Stab NA 21E (CAS: 151841-65-5) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use ADK Stab NA 21E (CAS: 151841-65-5)?

ADK Stab NA 21E (CAS: 151841-65-5) is widely used in various industries, including pharmaceuticals, ...

Compound Q&A

What precautions should be taken when handling ADK Stab NA 21E (CAS: 151841-65-5)?

When handling ADK Stab NA 21E (CAS: 151841-65-5), it is essential to use appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...