Compound Q&A

What are the physical and chemical properties of ADK Stab NA 21E (CAS: 151841-65-5)?

Answer

ADK Stab NA 21E
ADK Stab NA 21E (CAS: 151841-65-5) is a crystalline compound with a molecular weight of approximately 424.45 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is stable under normal conditions but can react with strong oxidizing agents. It has excellent thermal stability and is commonly used as an antioxidant.

About

English Name ADK Stab NA 21E
Molecular Formula C58H85AlO9P2
Molecular Weight 1015.22 g/mol
SMILES O[Al](OP1(=O)Oc2c(Cc3c(O1)c(cc(c3)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C)OP1(=O)Oc2c(Cc3c(O1)c(cc(c3)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C
InChIKey IQJARXJKVIARHO-UHFFFAOYSA-K
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is ADK Stab NA 21E (CAS: 151841-65-5) typically synthesized?

ADK Stab NA 21E (CAS: 151841-65-5) is typically synthesized through a multistep process involving th...

Compound Q&A

What industries use ADK Stab NA 21E (CAS: 151841-65-5)?

ADK Stab NA 21E (CAS: 151841-65-5) is widely used in various industries, including pharmaceuticals, ...

Compound Q&A

What precautions should be taken when handling ADK Stab NA 21E (CAS: 151841-65-5)?

When handling ADK Stab NA 21E (CAS: 151841-65-5), it is essential to use appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...