Compound Q&A

What industries use 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

Answer

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid
1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid finds applications in pharmaceuticals, where it serves as a precursor for drug synthesis. It is also used in the polymer industry for modifying polymer properties and in the semiconductor industry for creating specific functional groups required in device fabrication. Additionally, it is utilized in the development of sensors and other chemical reagents.

About

English Name 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid
Molecular Formula C12H11NO4S
Molecular Weight 265.29 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)C(=O)O
InChIKey UYHPMGMXSFLPOF-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid is a white to off-white crystalline solid ...

Compound Q&A

How is 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0) typically synthesized?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid is usually synthesized via a multi-step pr...

Compound Q&A

What precautions should be taken when handling 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

When handling 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid, it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...