Compound Q&A

What are the physical and chemical properties of 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

Answer

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid
1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid is a white to off-white crystalline solid with a molecular weight of approximately 315.27 g/mol. It has low aqueous solubility and good solubility in polar organic solvents. The compound is relatively stable under normal conditions but may react with strong bases. It is used in various applications requiring its unique chemical properties.

About

English Name 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid
Molecular Formula C12H11NO4S
Molecular Weight 265.29 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)C(=O)O
InChIKey UYHPMGMXSFLPOF-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0) typically synthesized?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid is usually synthesized via a multi-step pr...

Compound Q&A

What industries use 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid finds applications in pharmaceuticals, whe...

Compound Q&A

What precautions should be taken when handling 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

When handling 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid, it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...