Compound Q&A

How is 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0) typically synthesized?

Answer

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid
1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid is usually synthesized via a multi-step process involving the protection of a pyrrole ring, followed by sulfonylation and carboxylation. Key steps include the use of sulfonyl chlorides and carboxylic acids, with the reaction typically carried out in anhydrous conditions and under appropriate catalysts to ensure high yield and selectivity.

About

English Name 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid
Molecular Formula C12H11NO4S
Molecular Weight 265.29 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)C(=O)O
InChIKey UYHPMGMXSFLPOF-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid is a white to off-white crystalline solid ...

Compound Q&A

What industries use 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid finds applications in pharmaceuticals, whe...

Compound Q&A

What precautions should be taken when handling 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid (CAS: 106058-86-0)?

When handling 1-[(4-Methylphenyl)sulfonyl]-1H-pyrrole-3-carboxylic acid, it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...