Compound Q&A

What industries use 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9)?

Answer

2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate
2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of drugs. It also has applications in the production of certain polymers and in the development of new materials for sensors and semiconductors. Its use in these industries is growing due to its unique chemical properties and reactivity.

About

English Name 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate
Molecular Formula C14H19NO3
Molecular Weight 249.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)O
InChIKey IVHHZZKGSYGTKZ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9)?

2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate is a solid compound with a c...

Compound Q&A

How is 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9) typically synthesized?

2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate can be synthesized via a mul...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9)?

When handling 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate, it is crucial...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...