Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9)?

Answer

2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate
2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate is a solid compound with a crystalline form. The molecular weight is approximately 258.34 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo various transformations. It has a melting point of around 120-122°C and a boiling point of approximately 300°C.

About

English Name 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate
Molecular Formula C14H19NO3
Molecular Weight 249.31 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)O
InChIKey IVHHZZKGSYGTKZ-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9) typically synthesized?

2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate can be synthesized via a mul...

Compound Q&A

What industries use 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9)?

2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate (CAS: 158984-83-9)?

When handling 2-Methyl-2-propanyl 6-hydroxy-3,4-dihydro-2(1H)-isoquinolinecarboxylate, it is crucial...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...